C15H10F2N2O2 — CID 110700475
N-(3,4-difluorophenyl)-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 110700475) has the molecular formula C15H10F2N2O2 and a molecular weight of 288.25 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 110700475 |
| Molecular Formula | C15H10F2N2O2 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)Nc3ccc(F)c(F)c3)ccc2N1 |
| InChI | InChI=1S/C15H10F2N2O2/c16-11-3-2-10(7-12(11)17)18-15(21)8-1-4-13-9(5-8)6-14(20)19-13/h1-5,7H,6H2,(H,18,21)(H,19,20) |
| InChIKey | SMPNYCBWNMDIGZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |