C15H12N2O2S — CID 162521066
2-oxo-N-(4-sulfanylphenyl)-1,3-dihydroindole-6-carboxamide (PubChem CID 162521066) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-oxo-N-(4-sulfanylphenyl)-1,3-dihydroindole-6-carboxamide.
| Compound Name | 2-oxo-N-(4-sulfanylphenyl)-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 162521066 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-oxo-N-(4-sulfanylphenyl)-1,3-dihydroindole-6-carboxamide |
| SMILES | O=C1Cc2ccc(C(=O)Nc3ccc(S)cc3)cc2N1 |
| InChI | InChI=1S/C15H12N2O2S/c18-14-8-9-1-2-10(7-13(9)17-14)15(19)16-11-3-5-12(20)6-4-11/h1-7,20H,8H2,(H,16,19)(H,17,18) |
| InChIKey | FUVMTXKMRQKTIC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|