About 2-oxo-1,3-dihydroindole-6-carbonyl chloride
2-oxo-1,3-dihydroindole-6-carbonyl chloride (PubChem CID 141361971) has the molecular formula C9H6ClNO2
and a molecular weight of 195.61 g/mol. Its IUPAC name is 2-oxo-1,3-dihydroindole-6-carbonyl chloride.
Molecular Properties
| Compound Name | 2-oxo-1,3-dihydroindole-6-carbonyl chloride |
| PubChem CID | 141361971 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 2-oxo-1,3-dihydroindole-6-carbonyl chloride |
| SMILES | O=C1Cc2ccc(C(=O)Cl)cc2N1 |
| InChI | InChI=1S/C9H6ClNO2/c10-9(13)6-2-1-5-4-8(12)11-7(5)3-6/h1-3H,4H2,(H,11,12) |
| InChIKey | JCIGZPUXJILGPG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1,3-dihydroindole-6-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,3-dihydroindole-6-carbonyl chloride?
The IUPAC name of 2-oxo-1,3-dihydroindole-6-carbonyl chloride (CID 141361971) is 2-oxo-1,3-dihydroindole-6-carbonyl chloride.
What is the SMILES notation for 2-oxo-1,3-dihydroindole-6-carbonyl chloride?
The canonical SMILES for 2-oxo-1,3-dihydroindole-6-carbonyl chloride is O=C1Cc2ccc(C(=O)Cl)cc2N1.
What is the InChIKey of 2-oxo-1,3-dihydroindole-6-carbonyl chloride?
The InChIKey is JCIGZPUXJILGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2/c10-9(13)6-2-1-5-4-8(12)11-7(5)3-6/h1-3H,4H2,(H,11,12).
What are the key properties of 2-oxo-1,3-dihydroindole-6-carbonyl chloride?
2-oxo-1,3-dihydroindole-6-carbonyl chloride has a molecular weight of 195.61 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3-dihydroindole-6-carbonyl chloride is sourced from PubChem (CID 141361971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).