C13H11N3O4 — CID 102712523
4-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2,6-dione (PubChem CID 102712523) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 4-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 102712523 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2ccc3c(c2)NC(=O)C3)CC(=O)N1 |
| InChI | InChI=1S/C13H11N3O4/c17-10-4-7-1-2-8(3-9(7)14-10)13(20)16-5-11(18)15-12(19)6-16/h1-3H,4-6H2,(H,14,17)(H,15,18,19) |
| InChIKey | VWFPYOAHTLRXOK-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|