C14H16N2O2S — CID 102712777
6-(2-methylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 102712777) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 6-(2-methylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-(2-methylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 102712777 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 6-(2-methylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | CC1CN(C(=O)c2ccc3c(c2)NC(=O)C3)CCS1 |
| InChI | InChI=1S/C14H16N2O2S/c1-9-8-16(4-5-19-9)14(18)11-3-2-10-7-13(17)15-12(10)6-11/h2-3,6,9H,4-5,7-8H2,1H3,(H,15,17) |
| InChIKey | PRMFWVSBJNVGLP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |