C15H18N2O2S — CID 102712422
6-(2,6-dimethylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 102712422) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 6-(2,6-dimethylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-(2,6-dimethylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 102712422 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 6-(2,6-dimethylthiomorpholine-4-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | CC1CN(C(=O)c2ccc3c(c2)NC(=O)C3)CC(C)S1 |
| InChI | InChI=1S/C15H18N2O2S/c1-9-7-17(8-10(2)20-9)15(19)12-4-3-11-6-14(18)16-13(11)5-12/h3-5,9-10H,6-8H2,1-2H3,(H,16,18) |
| InChIKey | BZKMPRIFGPRDKP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |