C13H13N3O3 — CID 103999097
4-(2,3-dihydro-1H-isoindole-5-carbonyl)piperazine-2,6-dione (PubChem CID 103999097) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-isoindole-5-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(2,3-dihydro-1H-isoindole-5-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 103999097 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-(2,3-dihydro-1H-isoindole-5-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2ccc3c(c2)CNC3)CC(=O)N1 |
| InChI | InChI=1S/C13H13N3O3/c17-11-6-16(7-12(18)15-11)13(19)8-1-2-9-4-14-5-10(9)3-8/h1-3,14H,4-7H2,(H,15,17,18) |
| InChIKey | KTRFZZFLWQRWHY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|