C10H8N2O5 — CID 66084335
4-(6-oxopyran-3-carbonyl)piperazine-2,6-dione (PubChem CID 66084335) has the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. Its IUPAC name is 4-(6-oxopyran-3-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(6-oxopyran-3-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66084335 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-(6-oxopyran-3-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2ccc(=O)oc2)CC(=O)N1 |
| InChI | InChI=1S/C10H8N2O5/c13-7-3-12(4-8(14)11-7)10(16)6-1-2-9(15)17-5-6/h1-2,5H,3-4H2,(H,11,13,14) |
| InChIKey | HZTQAVIIOUFZIX-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|