C12H12N4O4 — CID 77111806
4-(3,5-dioxopiperazine-1-carbonyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 77111806) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 4-(3,5-dioxopiperazine-1-carbonyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(3,5-dioxopiperazine-1-carbonyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77111806 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-(3,5-dioxopiperazine-1-carbonyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(C(=O)N2CC(=O)NC(=O)C2)cc1 |
| InChI | InChI=1S/C12H12N4O4/c13-11(15-20)7-1-3-8(4-2-7)12(19)16-5-9(17)14-10(18)6-16/h1-4,20H,5-6H2,(H2,13,15)(H,14,17,18) |
| InChIKey | AUEMHIDDCYZEEX-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|