C14H17N3O2 — CID 102712663
2-oxo-N-piperidin-1-yl-1,3-dihydroindole-6-carboxamide (PubChem CID 102712663) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-oxo-N-piperidin-1-yl-1,3-dihydroindole-6-carboxamide.
| Compound Name | 2-oxo-N-piperidin-1-yl-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102712663 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-oxo-N-piperidin-1-yl-1,3-dihydroindole-6-carboxamide |
| SMILES | O=C1Cc2ccc(C(=O)NN3CCCCC3)cc2N1 |
| InChI | InChI=1S/C14H17N3O2/c18-13-9-10-4-5-11(8-12(10)15-13)14(19)16-17-6-2-1-3-7-17/h4-5,8H,1-3,6-7,9H2,(H,15,18)(H,16,19) |
| InChIKey | GIBKPMUOWAJNBM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |