C13H14N2O5 — CID 102710593
3-hydroxy-2-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid (PubChem CID 102710593) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-hydroxy-2-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 102710593 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-hydroxy-2-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid |
| SMILES | CC(O)C(NC(=O)c1ccc2c(c1)NC(=O)C2)C(=O)O |
| InChI | InChI=1S/C13H14N2O5/c1-6(16)11(13(19)20)15-12(18)8-3-2-7-5-10(17)14-9(7)4-8/h2-4,6,11,16H,5H2,1H3,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | AAHDMEWIFQQFSW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |