C16H22N2O2 — CID 102711809
N-heptan-2-yl-2-oxo-1,3-dihydroindole-6-carboxamide (PubChem CID 102711809) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-heptan-2-yl-2-oxo-1,3-dihydroindole-6-carboxamide.
| Compound Name | N-heptan-2-yl-2-oxo-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102711809 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-heptan-2-yl-2-oxo-1,3-dihydroindole-6-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C16H22N2O2/c1-3-4-5-6-11(2)17-16(20)13-8-7-12-10-15(19)18-14(12)9-13/h7-9,11H,3-6,10H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | GPOAUTSJYUPAGP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|