C15H20N2O3 — CID 102712158
2-oxo-N-(3-propan-2-yloxypropyl)-1,3-dihydroindole-6-carboxamide (PubChem CID 102712158) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-oxo-N-(3-propan-2-yloxypropyl)-1,3-dihydroindole-6-carboxamide.
| Compound Name | 2-oxo-N-(3-propan-2-yloxypropyl)-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102712158 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-oxo-N-(3-propan-2-yloxypropyl)-1,3-dihydroindole-6-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C15H20N2O3/c1-10(2)20-7-3-6-16-15(19)12-5-4-11-9-14(18)17-13(11)8-12/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | SNZAHLJYGFJYPU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|