C14H16N2O4 — CID 102710806
3-methyl-4-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid (PubChem CID 102710806) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-methyl-4-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid.
| Compound Name | 3-methyl-4-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 102710806 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-methyl-4-[(2-oxo-1,3-dihydroindole-6-carbonyl)amino]butanoic acid |
| SMILES | CC(CNC(=O)c1ccc2c(c1)NC(=O)C2)CC(=O)O |
| InChI | InChI=1S/C14H16N2O4/c1-8(4-13(18)19)7-15-14(20)10-3-2-9-6-12(17)16-11(9)5-10/h2-3,5,8H,4,6-7H2,1H3,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | CXBVSKWDXRTDPA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |