C13H10N4O2 — CID 102711862
N,N-bis(cyanomethyl)-2-oxo-1,3-dihydroindole-6-carboxamide (PubChem CID 102711862) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-oxo-1,3-dihydroindole-6-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-2-oxo-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102711862 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-oxo-1,3-dihydroindole-6-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C13H10N4O2/c14-3-5-17(6-4-15)13(19)10-2-1-9-8-12(18)16-11(9)7-10/h1-2,7H,5-6,8H2,(H,16,18) |
| InChIKey | AQMBKTVCRFOHOZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|