C13H12N4O — CID 103997742
N,N-bis(cyanomethyl)-2,3-dihydro-1H-isoindole-5-carboxamide (PubChem CID 103997742) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2,3-dihydro-1H-isoindole-5-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 103997742 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N,N-bis(cyanomethyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C13H12N4O/c14-3-5-17(6-4-15)13(18)10-1-2-11-8-16-9-12(11)7-10/h1-2,7,16H,5-6,8-9H2 |
| InChIKey | AJHJMNKMVZJEAX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|