C16H12N6O2 — CID 668910
1-N,1-N,3-N,3-N-tetrakis(cyanomethyl)benzene-1,3-dicarboxamide (PubChem CID 668910) has the molecular formula C16H12N6O2 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrakis(cyanomethyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,1-N,3-N,3-N-tetrakis(cyanomethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 668910 |
| Molecular Formula | C16H12N6O2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrakis(cyanomethyl)benzene-1,3-dicarboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1cccc(C(=O)N(CC#N)CC#N)c1 |
| InChI | InChI=1S/C16H12N6O2/c17-4-8-21(9-5-18)15(23)13-2-1-3-14(12-13)16(24)22(10-6-19)11-7-20/h1-3,12H,8-11H2 |
| InChIKey | WFOMSUWJSCHDBS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 135.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|