C11H8Cl2N4O — CID 82833195
4-amino-3,5-dichloro-N,N-bis(cyanomethyl)benzamide (PubChem CID 82833195) has the molecular formula C11H8Cl2N4O and a molecular weight of 283.12 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N,N-bis(cyanomethyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N,N-bis(cyanomethyl)benzamide |
|---|---|
| PubChem CID | 82833195 |
| Molecular Formula | C11H8Cl2N4O |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 4-amino-3,5-dichloro-N,N-bis(cyanomethyl)benzamide |
| SMILES | N#CCN(CC#N)C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2N4O/c12-8-5-7(6-9(13)10(8)16)11(18)17(3-1-14)4-2-15/h5-6H,3-4,16H2 |
| InChIKey | UEIOKGGKHVPBKX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|