C15H16ClN3O3 — CID 78805821
3-chloro-N,N-bis(cyanomethyl)-5-methoxy-4-propoxybenzamide (PubChem CID 78805821) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 3-chloro-N,N-bis(cyanomethyl)-5-methoxy-4-propoxybenzamide.
| Compound Name | 3-chloro-N,N-bis(cyanomethyl)-5-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 78805821 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-chloro-N,N-bis(cyanomethyl)-5-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)N(CC#N)CC#N)cc1OC |
| InChI | InChI=1S/C15H16ClN3O3/c1-3-8-22-14-12(16)9-11(10-13(14)21-2)15(20)19(6-4-17)7-5-18/h9-10H,3,6-8H2,1-2H3 |
| InChIKey | DVQORXIHVCIXMT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|