C13H13N3O3 — CID 669334
N,N-bis(cyanomethyl)-3,4-dimethoxybenzamide (PubChem CID 669334) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-3,4-dimethoxybenzamide.
| Compound Name | N,N-bis(cyanomethyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 669334 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N,N-bis(cyanomethyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CC#N)CC#N)cc1OC |
| InChI | InChI=1S/C13H13N3O3/c1-18-11-4-3-10(9-12(11)19-2)13(17)16(7-5-14)8-6-15/h3-4,9H,7-8H2,1-2H3 |
| InChIKey | GZUJYYKDHAQDKU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|