C11H7Cl2N3O — CID 5018129
3,4-dichloro-N,N-bis(cyanomethyl)benzamide (PubChem CID 5018129) has the molecular formula C11H7Cl2N3O and a molecular weight of 268.10 g/mol. Its IUPAC name is 3,4-dichloro-N,N-bis(cyanomethyl)benzamide.
| Compound Name | 3,4-dichloro-N,N-bis(cyanomethyl)benzamide |
|---|---|
| PubChem CID | 5018129 |
| Molecular Formula | C11H7Cl2N3O |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 3,4-dichloro-N,N-bis(cyanomethyl)benzamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl2N3O/c12-9-2-1-8(7-10(9)13)11(17)16(5-3-14)6-4-15/h1-2,7H,5-6H2 |
| InChIKey | UTEWKCKOMJKTEA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|