C10H7FN4O — CID 63971968
N,N-bis(cyanomethyl)-6-fluoropyridine-3-carboxamide (PubChem CID 63971968) has the molecular formula C10H7FN4O and a molecular weight of 218.19 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-6-fluoropyridine-3-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 63971968 |
| Molecular Formula | C10H7FN4O |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | N,N-bis(cyanomethyl)-6-fluoropyridine-3-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C10H7FN4O/c11-9-2-1-8(7-14-9)10(16)15(5-3-12)6-4-13/h1-2,7H,5-6H2 |
| InChIKey | GGRKZTNUDMEFFI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|