C13H15N5O — CID 55042439
N,N-bis(cyanomethyl)-6-(propylamino)pyridine-3-carboxamide (PubChem CID 55042439) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-6-(propylamino)pyridine-3-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-6-(propylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55042439 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N,N-bis(cyanomethyl)-6-(propylamino)pyridine-3-carboxamide |
| SMILES | CCCNc1ccc(C(=O)N(CC#N)CC#N)cn1 |
| InChI | InChI=1S/C13H15N5O/c1-2-7-16-12-4-3-11(10-17-12)13(19)18(8-5-14)9-6-15/h3-4,10H,2,7-9H2,1H3,(H,16,17) |
| InChIKey | RSABGPCADAYAQZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|