C12H11FN4O — CID 63979683
N,N-bis(2-cyanoethyl)-6-fluoropyridine-3-carboxamide (PubChem CID 63979683) has the molecular formula C12H11FN4O and a molecular weight of 246.24 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-6-fluoropyridine-3-carboxamide.
| Compound Name | N,N-bis(2-cyanoethyl)-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 63979683 |
| Molecular Formula | C12H11FN4O |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-6-fluoropyridine-3-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C12H11FN4O/c13-11-4-3-10(9-16-11)12(18)17(7-1-5-14)8-2-6-15/h3-4,9H,1-2,7-8H2 |
| InChIKey | JQEBPCCOLBUSPX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|