C12H12N4O — CID 51179878
N,N-bis(2-cyanoethyl)pyridine-4-carboxamide (PubChem CID 51179878) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)pyridine-4-carboxamide.
| Compound Name | N,N-bis(2-cyanoethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 51179878 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N,N-bis(2-cyanoethyl)pyridine-4-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1ccncc1 |
| InChI | InChI=1S/C12H12N4O/c13-5-1-9-16(10-2-6-14)12(17)11-3-7-15-8-4-11/h3-4,7-8H,1-2,9-10H2 |
| InChIKey | QXUITCBHNYTCOG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |