C15H16N4O — CID 60953943
N,N-bis(2-cyanoethyl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 60953943) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 60953943 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C15H16N4O/c16-6-1-9-19(10-2-7-17)15(20)13-3-4-14-12(11-13)5-8-18-14/h3-4,11,18H,1-2,5,8-10H2 |
| InChIKey | DEMGGNFUNIBIJI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |