C15H22Cl2N2O2 — CID 82812492
4-amino-3,5-dichloro-N-hexyl-N-(2-hydroxyethyl)benzamide (PubChem CID 82812492) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-hexyl-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-hexyl-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 82812492 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-amino-3,5-dichloro-N-hexyl-N-(2-hydroxyethyl)benzamide |
| SMILES | CCCCCCN(CCO)C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O2/c1-2-3-4-5-6-19(7-8-20)15(21)11-9-12(16)14(18)13(17)10-11/h9-10,20H,2-8,18H2,1H3 |
| InChIKey | SIBZRDTUQLRZEM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|