C13H17Cl2N3O2 — CID 82833354
4-amino-3,5-dichloro-N-[2-(methylamino)-2-oxoethyl]-N-propylbenzamide (PubChem CID 82833354) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[2-(methylamino)-2-oxoethyl]-N-propylbenzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[2-(methylamino)-2-oxoethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 82833354 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[2-(methylamino)-2-oxoethyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)NC)C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-3-4-18(7-11(19)17-2)13(20)8-5-9(14)12(16)10(15)6-8/h5-6H,3-4,7,16H2,1-2H3,(H,17,19) |
| InChIKey | MAXAQBXMWOAPPQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|