C14H22ClN3O — CID 55042069
6-amino-N,N-dibutyl-5-chloropyridine-3-carboxamide (PubChem CID 55042069) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 6-amino-N,N-dibutyl-5-chloropyridine-3-carboxamide.
| Compound Name | 6-amino-N,N-dibutyl-5-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 55042069 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 6-amino-N,N-dibutyl-5-chloropyridine-3-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClN3O/c1-3-5-7-18(8-6-4-2)14(19)11-9-12(15)13(16)17-10-11/h9-10H,3-8H2,1-2H3,(H2,16,17) |
| InChIKey | QRTQVTWVQSUZRI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |