C14H20Cl2N2O3 — CID 82961174
5,6-dichloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide (PubChem CID 82961174) has the molecular formula C14H20Cl2N2O3 and a molecular weight of 335.23 g/mol. Its IUPAC name is 5,6-dichloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 82961174 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5,6-dichloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O3/c1-3-20-7-5-18(6-8-21-4-2)14(19)11-9-12(15)13(16)17-10-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | QRAHVXANSDGNGY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|