C14H21ClN2O3 — CID 82966067
6-chloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide (PubChem CID 82966067) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 6-chloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 82966067 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 6-chloro-N,N-bis(2-ethoxyethyl)pyridine-3-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H21ClN2O3/c1-3-19-9-7-17(8-10-20-4-2)14(18)12-5-6-13(15)16-11-12/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | IRYQQCDOELUGMH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|