C10H11ClN4O3 — CID 62923762
N,N-bis(2-amino-2-oxoethyl)-6-chloropyridine-3-carboxamide (PubChem CID 62923762) has the molecular formula C10H11ClN4O3 and a molecular weight of 270.68 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-6-chloropyridine-3-carboxamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 62923762 |
| Molecular Formula | C10H11ClN4O3 |
| Molecular Weight | 270.68 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-6-chloropyridine-3-carboxamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H11ClN4O3/c11-7-2-1-6(3-14-7)10(18)15(4-8(12)16)5-9(13)17/h1-3H,4-5H2,(H2,12,16)(H2,13,17) |
| InChIKey | CNWNVGUOIWHFNO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.68 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|