C14H12Cl3N3O2 — CID 159595421
6-chloro-N,N-dimethylpyridine-3-carboxamide;6-chloropyridine-3-carbonyl chloride (PubChem CID 159595421) has the molecular formula C14H12Cl3N3O2 and a molecular weight of 360.63 g/mol. Its IUPAC name is 6-chloro-N,N-dimethylpyridine-3-carboxamide;6-chloropyridine-3-carbonyl chloride.
| Compound Name | 6-chloro-N,N-dimethylpyridine-3-carboxamide;6-chloropyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 159595421 |
| Molecular Formula | C14H12Cl3N3O2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 6-chloro-N,N-dimethylpyridine-3-carboxamide;6-chloropyridine-3-carbonyl chloride |
| SMILES | CN(C)C(=O)c1ccc(Cl)nc1.O=C(Cl)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H9ClN2O.C6H3Cl2NO/c1-11(2)8(12)6-3-4-7(9)10-5-6;7-5-2-1-4(3-9-5)6(8)10/h3-5H,1-2H3;1-3H |
| InChIKey | MKTVSRTXJZPVEJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|