About 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride
6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride (PubChem CID 158925044) has the molecular formula C12H8Cl4N2O3
and a molecular weight of 370.02 g/mol. Its IUPAC name is 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride |
| PubChem CID | 158925044 |
| Molecular Formula | C12H8Cl4N2O3 |
| Molecular Weight | 370.02 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(Cl)c1ccc(Cl)nc1.O=C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C6H3Cl2NO.C6H4ClNO2.ClH/c7-5-2-1-4(3-9-5)6(8)10;7-5-2-1-4(3-8-5)6(9)10;/h1-3H;1-3H,(H,9,10);1H |
| InChIKey | LAEANXQOVUUYFU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.02 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride?
The IUPAC name of 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride (CID 158925044) is 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride?
The canonical SMILES for 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride is Cl.O=C(Cl)c1ccc(Cl)nc1.O=C(O)c1ccc(Cl)nc1.
What is the InChIKey of 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride?
The InChIKey is LAEANXQOVUUYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2NO.C6H4ClNO2.ClH/c7-5-2-1-4(3-9-5)6(8)10;7-5-2-1-4(3-8-5)6(9)10;/h1-3H;1-3H,(H,9,10);1H.
What are the key properties of 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride?
6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride has a molecular weight of 370.02 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyridine-3-carbonyl chloride;6-chloropyridine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 158925044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).