About 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate
6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate (PubChem CID 87954939) has the molecular formula C18H12Cl2N2O4
and a molecular weight of 391.21 g/mol. Its IUPAC name is 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate |
| PubChem CID | 87954939 |
| Molecular Formula | C18H12Cl2N2O4 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate |
| SMILES | O=C(O)c1ccc(Cl)nc1.O=C(Oc1ccccc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H8ClNO2.C6H4ClNO2/c13-11-7-6-9(8-14-11)12(15)16-10-4-2-1-3-5-10;7-5-2-1-4(3-8-5)6(9)10/h1-8H;1-3H,(H,9,10) |
| InChIKey | BKYMFLJJVVWABP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate?
The IUPAC name of 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate (CID 87954939) is 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate.
What is the SMILES notation for 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate?
The canonical SMILES for 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate is O=C(O)c1ccc(Cl)nc1.O=C(Oc1ccccc1)c1ccc(Cl)nc1.
What is the InChIKey of 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate?
The InChIKey is BKYMFLJJVVWABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClNO2.C6H4ClNO2/c13-11-7-6-9(8-14-11)12(15)16-10-4-2-1-3-5-10;7-5-2-1-4(3-8-5)6(9)10/h1-8H;1-3H,(H,9,10).
What are the key properties of 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate?
6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate has a molecular weight of 391.21 g/mol, XLogP of 4.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyridine-3-carboxylic acid;phenyl 6-chloropyridine-3-carboxylate is sourced from PubChem (CID 87954939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).