C6H5Cl2NO3 — CID 159285207
carbonic acid;2,5-dichloropyridine (PubChem CID 159285207) has the molecular formula C6H5Cl2NO3 and a molecular weight of 210.02 g/mol. Its IUPAC name is carbonic acid;2,5-dichloropyridine.
| Compound Name | carbonic acid;2,5-dichloropyridine |
|---|---|
| PubChem CID | 159285207 |
| Molecular Formula | C6H5Cl2NO3 |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 208.96 |
| IUPAC Name | carbonic acid;2,5-dichloropyridine |
| SMILES | Clc1ccc(Cl)nc1.O=C(O)O |
| InChI | InChI=1S/C5H3Cl2N.CH2O3/c6-4-1-2-5(7)8-3-4;2-1(3)4/h1-3H;(H2,2,3,4) |
| InChIKey | KZKQWQAGQQTWFM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|