C7H10Cl2N2O — CID 174948655
2,5-dichloropyridine;N-ethylhydroxylamine (PubChem CID 174948655) has the molecular formula C7H10Cl2N2O and a molecular weight of 209.08 g/mol. Its IUPAC name is 2,5-dichloropyridine;N-ethylhydroxylamine.
| Compound Name | 2,5-dichloropyridine;N-ethylhydroxylamine |
|---|---|
| PubChem CID | 174948655 |
| Molecular Formula | C7H10Cl2N2O |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 2,5-dichloropyridine;N-ethylhydroxylamine |
| SMILES | CCNO.Clc1ccc(Cl)nc1 |
| InChI | InChI=1S/C5H3Cl2N.C2H7NO/c6-4-1-2-5(7)8-3-4;1-2-3-4/h1-3H;3-4H,2H2,1H3 |
| InChIKey | OELHRDNQVXGAFA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|