C10H13ClN2O2 — CID 103920023
5-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-2-carboxamide (PubChem CID 103920023) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 5-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103920023 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 5-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-2-carboxamide |
| SMILES | CC[C@H](CO)NC(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C10H13ClN2O2/c1-2-8(6-14)13-10(15)9-4-3-7(11)5-12-9/h3-5,8,14H,2,6H2,1H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | NKXSHNPEGIWIPI-MRVPVSSYSA-N |
| XLogP | 1.24 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |