C10H11Cl3N2O2 — CID 93041499
3,4,5-trichloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-2-carboxamide (PubChem CID 93041499) has the molecular formula C10H11Cl3N2O2 and a molecular weight of 297.57 g/mol. Its IUPAC name is 3,4,5-trichloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-2-carboxamide.
| Compound Name | 3,4,5-trichloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 93041499 |
| Molecular Formula | C10H11Cl3N2O2 |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 3,4,5-trichloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-2-carboxamide |
| SMILES | CC[C@@H](CO)NC(=O)c1ncc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl3N2O2/c1-2-5(4-16)15-10(17)9-8(13)7(12)6(11)3-14-9/h3,5,16H,2,4H2,1H3,(H,15,17)/t5-/m0/s1 |
| InChIKey | PXBSQEXRQSJYIF-YFKPBYRVSA-N |
| XLogP | 2.54 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |