C12H13Cl3N2O3 — CID 43387014
2-[(3,4,5-trichloropyridine-2-carbonyl)amino]hexanoic acid (PubChem CID 43387014) has the molecular formula C12H13Cl3N2O3 and a molecular weight of 339.61 g/mol. Its IUPAC name is 2-[(3,4,5-trichloropyridine-2-carbonyl)amino]hexanoic acid.
| Compound Name | 2-[(3,4,5-trichloropyridine-2-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 43387014 |
| Molecular Formula | C12H13Cl3N2O3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-[(3,4,5-trichloropyridine-2-carbonyl)amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)c1ncc(Cl)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C12H13Cl3N2O3/c1-2-3-4-7(12(19)20)17-11(18)10-9(15)8(14)6(13)5-16-10/h5,7H,2-4H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | XHGLIRZKZNECJF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |