C10H12BrClN2O — CID 114294391
5-bromo-N-(1-chlorobutan-2-yl)pyridine-2-carboxamide (PubChem CID 114294391) has the molecular formula C10H12BrClN2O and a molecular weight of 291.58 g/mol. Its IUPAC name is 5-bromo-N-(1-chlorobutan-2-yl)pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-(1-chlorobutan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114294391 |
| Molecular Formula | C10H12BrClN2O |
| Molecular Weight | 291.58 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 5-bromo-N-(1-chlorobutan-2-yl)pyridine-2-carboxamide |
| SMILES | CCC(CCl)NC(=O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C10H12BrClN2O/c1-2-8(5-12)14-10(15)9-4-3-7(11)6-13-9/h3-4,6,8H,2,5H2,1H3,(H,14,15) |
| InChIKey | YLYIFILYBXULRK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|