About butan-1-ol;5-chloropyridin-2-amine
butan-1-ol;5-chloropyridin-2-amine (PubChem CID 174845448) has the molecular formula C9H15ClN2O
and a molecular weight of 202.69 g/mol. Its IUPAC name is butan-1-ol;5-chloropyridin-2-amine.
Molecular Properties
| Compound Name | butan-1-ol;5-chloropyridin-2-amine |
| PubChem CID | 174845448 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | butan-1-ol;5-chloropyridin-2-amine |
| SMILES | CCCCO.Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C5H5ClN2.C4H10O/c6-4-1-2-5(7)8-3-4;1-2-3-4-5/h1-3H,(H2,7,8);5H,2-4H2,1H3 |
| InChIKey | ARJIHCRWYWTQJI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-1-ol;5-chloropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;5-chloropyridin-2-amine?
The IUPAC name of butan-1-ol;5-chloropyridin-2-amine (CID 174845448) is butan-1-ol;5-chloropyridin-2-amine.
What is the SMILES notation for butan-1-ol;5-chloropyridin-2-amine?
The canonical SMILES for butan-1-ol;5-chloropyridin-2-amine is CCCCO.Nc1ccc(Cl)cn1.
What is the InChIKey of butan-1-ol;5-chloropyridin-2-amine?
The InChIKey is ARJIHCRWYWTQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2.C4H10O/c6-4-1-2-5(7)8-3-4;1-2-3-4-5/h1-3H,(H2,7,8);5H,2-4H2,1H3.
What are the key properties of butan-1-ol;5-chloropyridin-2-amine?
butan-1-ol;5-chloropyridin-2-amine has a molecular weight of 202.69 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;5-chloropyridin-2-amine is sourced from PubChem (CID 174845448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).