About benzene-1,4-diamine;pentan-1-ol
benzene-1,4-diamine;pentan-1-ol (PubChem CID 174707201) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is benzene-1,4-diamine;pentan-1-ol.
Molecular Properties
| Compound Name | benzene-1,4-diamine;pentan-1-ol |
| PubChem CID | 174707201 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | benzene-1,4-diamine;pentan-1-ol |
| SMILES | CCCCCO.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C6H8N2.C5H12O/c7-5-1-2-6(8)4-3-5;1-2-3-4-5-6/h1-4H,7-8H2;6H,2-5H2,1H3 |
| InChIKey | UPPJNACNHXOUBG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diamine;pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diamine;pentan-1-ol?
The IUPAC name of benzene-1,4-diamine;pentan-1-ol (CID 174707201) is benzene-1,4-diamine;pentan-1-ol.
What is the SMILES notation for benzene-1,4-diamine;pentan-1-ol?
The canonical SMILES for benzene-1,4-diamine;pentan-1-ol is CCCCCO.Nc1ccc(N)cc1.
What is the InChIKey of benzene-1,4-diamine;pentan-1-ol?
The InChIKey is UPPJNACNHXOUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C5H12O/c7-5-1-2-6(8)4-3-5;1-2-3-4-5-6/h1-4H,7-8H2;6H,2-5H2,1H3.
What are the key properties of benzene-1,4-diamine;pentan-1-ol?
benzene-1,4-diamine;pentan-1-ol has a molecular weight of 196.29 g/mol, XLogP of 2.02, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diamine;pentan-1-ol is sourced from PubChem (CID 174707201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).