C12H22N2O2 — CID 139054112
benzene-1,4-diamine;hexane-1,6-diol (PubChem CID 139054112) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is benzene-1,4-diamine;hexane-1,6-diol.
| Compound Name | benzene-1,4-diamine;hexane-1,6-diol |
|---|---|
| PubChem CID | 139054112 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | benzene-1,4-diamine;hexane-1,6-diol |
| SMILES | Nc1ccc(N)cc1.OCCCCCCO |
| InChI | InChI=1S/C6H8N2.C6H14O2/c7-5-1-2-6(8)4-3-5;7-5-3-1-2-4-6-8/h1-4H,7-8H2;7-8H,1-6H2 |
| InChIKey | WRHQTSGXVQLDDQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|