About benzene-1,2-diamine;butan-1-ol;dihydrochloride
benzene-1,2-diamine;butan-1-ol;dihydrochloride (PubChem CID 174374290) has the molecular formula C10H20Cl2N2O
and a molecular weight of 255.19 g/mol. Its IUPAC name is benzene-1,2-diamine;butan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | benzene-1,2-diamine;butan-1-ol;dihydrochloride |
| PubChem CID | 174374290 |
| Molecular Formula | C10H20Cl2N2O |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | benzene-1,2-diamine;butan-1-ol;dihydrochloride |
| SMILES | CCCCO.Cl.Cl.Nc1ccccc1N |
| InChI | InChI=1S/C6H8N2.C4H10O.2ClH/c7-5-3-1-2-4-6(5)8;1-2-3-4-5;;/h1-4H,7-8H2;5H,2-4H2,1H3;2*1H |
| InChIKey | KWSUPIOSTNAZGZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;butan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;butan-1-ol;dihydrochloride?
The IUPAC name of benzene-1,2-diamine;butan-1-ol;dihydrochloride (CID 174374290) is benzene-1,2-diamine;butan-1-ol;dihydrochloride.
What is the SMILES notation for benzene-1,2-diamine;butan-1-ol;dihydrochloride?
The canonical SMILES for benzene-1,2-diamine;butan-1-ol;dihydrochloride is CCCCO.Cl.Cl.Nc1ccccc1N.
What is the InChIKey of benzene-1,2-diamine;butan-1-ol;dihydrochloride?
The InChIKey is KWSUPIOSTNAZGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C4H10O.2ClH/c7-5-3-1-2-4-6(5)8;1-2-3-4-5;;/h1-4H,7-8H2;5H,2-4H2,1H3;2*1H.
What are the key properties of benzene-1,2-diamine;butan-1-ol;dihydrochloride?
benzene-1,2-diamine;butan-1-ol;dihydrochloride has a molecular weight of 255.19 g/mol, XLogP of 2.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;butan-1-ol;dihydrochloride is sourced from PubChem (CID 174374290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).