About benzene-1,2-diamine;N-deuteriopentan-1-amine
benzene-1,2-diamine;N-deuteriopentan-1-amine (PubChem CID 174435241) has the molecular formula C11H21N3
and a molecular weight of 196.32 g/mol. Its IUPAC name is benzene-1,2-diamine;N-deuteriopentan-1-amine.
Molecular Properties
| Compound Name | benzene-1,2-diamine;N-deuteriopentan-1-amine |
| PubChem CID | 174435241 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | benzene-1,2-diamine;N-deuteriopentan-1-amine |
| SMILES | Nc1ccccc1N.[2H]NCCCCC |
| InChI | InChI=1S/C6H8N2.C5H13N/c7-5-3-1-2-4-6(5)8;1-2-3-4-5-6/h1-4H,7-8H2;2-6H2,1H3/i/hD |
| InChIKey | DAWRFVNYSKXBLI-DYCDLGHISA-N |
| XLogP | 1.99 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;N-deuteriopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;N-deuteriopentan-1-amine?
The IUPAC name of benzene-1,2-diamine;N-deuteriopentan-1-amine (CID 174435241) is benzene-1,2-diamine;N-deuteriopentan-1-amine.
What is the SMILES notation for benzene-1,2-diamine;N-deuteriopentan-1-amine?
The canonical SMILES for benzene-1,2-diamine;N-deuteriopentan-1-amine is Nc1ccccc1N.[2H]NCCCCC.
What is the InChIKey of benzene-1,2-diamine;N-deuteriopentan-1-amine?
The InChIKey is DAWRFVNYSKXBLI-DYCDLGHISA-N. The full InChI is InChI=1S/C6H8N2.C5H13N/c7-5-3-1-2-4-6(5)8;1-2-3-4-5-6/h1-4H,7-8H2;2-6H2,1H3/i/hD.
What are the key properties of benzene-1,2-diamine;N-deuteriopentan-1-amine?
benzene-1,2-diamine;N-deuteriopentan-1-amine has a molecular weight of 196.32 g/mol, XLogP of 1.99, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;N-deuteriopentan-1-amine is sourced from PubChem (CID 174435241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).