About 2-tetradecylaniline
2-tetradecylaniline (PubChem CID 22218918) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 2-tetradecylaniline.
Molecular Properties
| Compound Name | 2-tetradecylaniline |
| PubChem CID | 22218918 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 2-tetradecylaniline |
| SMILES | CCCCCCCCCCCCCCc1ccccc1N |
| InChI | InChI=1S/C20H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18-20(19)21/h14-15,17-18H,2-13,16,21H2,1H3 |
| InChIKey | UAEWPGUFBCWKAJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-tetradecylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tetradecylaniline?
The IUPAC name of 2-tetradecylaniline (CID 22218918) is 2-tetradecylaniline.
What is the SMILES notation for 2-tetradecylaniline?
The canonical SMILES for 2-tetradecylaniline is CCCCCCCCCCCCCCc1ccccc1N.
What is the InChIKey of 2-tetradecylaniline?
The InChIKey is UAEWPGUFBCWKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18-20(19)21/h14-15,17-18H,2-13,16,21H2,1H3.
What are the key properties of 2-tetradecylaniline?
2-tetradecylaniline has a molecular weight of 289.51 g/mol, XLogP of 6.51, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tetradecylaniline is sourced from PubChem (CID 22218918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).