C12H17F2N — CID 70016284
2-(6,6-difluorohexyl)aniline (PubChem CID 70016284) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 2-(6,6-difluorohexyl)aniline.
| Compound Name | 2-(6,6-difluorohexyl)aniline |
|---|---|
| PubChem CID | 70016284 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-(6,6-difluorohexyl)aniline |
| SMILES | Nc1ccccc1CCCCCC(F)F |
| InChI | InChI=1S/C12H17F2N/c13-12(14)9-3-1-2-6-10-7-4-5-8-11(10)15/h4-5,7-8,12H,1-3,6,9,15H2 |
| InChIKey | RUTUWJCMYPTSRB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|