C11H12F2O2-2 — CID 154435340
3-(5,5-difluoropentyl)benzene-1,2-diolate (PubChem CID 154435340) has the molecular formula C11H12F2O2-2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 3-(5,5-difluoropentyl)benzene-1,2-diolate.
| Compound Name | 3-(5,5-difluoropentyl)benzene-1,2-diolate |
|---|---|
| PubChem CID | 154435340 |
| Molecular Formula | C11H12F2O2-2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-(5,5-difluoropentyl)benzene-1,2-diolate |
| SMILES | [O-]c1cccc(CCCCC(F)F)c1[O-] |
| InChI | InChI=1S/C11H14F2O2/c12-10(13)7-2-1-4-8-5-3-6-9(14)11(8)15/h3,5-6,10,14-15H,1-2,4,7H2/p-2 |
| InChIKey | UUHUOOTWERVBLH-UHFFFAOYSA-L |
| XLogP | 1.81 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|