About barium(2+);bis(2-decylphenolate)
barium(2+);bis(2-decylphenolate) (PubChem CID 101292606) has the molecular formula C32H50BaO2
and a molecular weight of 604.08 g/mol. Its IUPAC name is barium(2+);bis(2-decylphenolate).
Molecular Properties
| Compound Name | barium(2+);bis(2-decylphenolate) |
| PubChem CID | 101292606 |
| Molecular Formula | C32H50BaO2 |
| Molecular Weight | 604.08 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | barium(2+);bis(2-decylphenolate) |
| SMILES | CCCCCCCCCCc1ccccc1[O-].CCCCCCCCCCc1ccccc1[O-].[Ba+2] |
| InChI | InChI=1S/2C16H26O.Ba/c2*1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-16(15)17;/h2*10-11,13-14,17H,2-9,12H2,1H3;/q;;+2/p-2 |
| InChIKey | IZAGTOIJUSIUJU-UHFFFAOYSA-L |
| XLogP | 8.51 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.08 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(2-decylphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-decylphenolate)?
The IUPAC name of barium(2+);bis(2-decylphenolate) (CID 101292606) is barium(2+);bis(2-decylphenolate).
What is the SMILES notation for barium(2+);bis(2-decylphenolate)?
The canonical SMILES for barium(2+);bis(2-decylphenolate) is CCCCCCCCCCc1ccccc1[O-].CCCCCCCCCCc1ccccc1[O-].[Ba+2].
What is the InChIKey of barium(2+);bis(2-decylphenolate)?
The InChIKey is IZAGTOIJUSIUJU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H26O.Ba/c2*1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-16(15)17;/h2*10-11,13-14,17H,2-9,12H2,1H3;/q;;+2/p-2.
What are the key properties of barium(2+);bis(2-decylphenolate)?
barium(2+);bis(2-decylphenolate) has a molecular weight of 604.08 g/mol, XLogP of 8.51, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-decylphenolate) is sourced from PubChem (CID 101292606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).